C13H19NO3 — CID 82388999
1-(2-aminoethyl)-5,6-dimethoxy-2,3-dihydroinden-1-ol (PubChem CID 82388999) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-(2-aminoethyl)-5,6-dimethoxy-2,3-dihydroinden-1-ol.
| Compound Name | 1-(2-aminoethyl)-5,6-dimethoxy-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 82388999 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 1-(2-aminoethyl)-5,6-dimethoxy-2,3-dihydroinden-1-ol |
| SMILES | COc1cc2c(cc1OC)C(O)(CCN)CC2 |
| InChI | InChI=1S/C13H19NO3/c1-16-11-7-9-3-4-13(15,5-6-14)10(9)8-12(11)17-2/h7-8,15H,3-6,14H2,1-2H3 |
| InChIKey | DWNBCSMLQCTHLT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |