C10H9F3OS — CID 82389818
3-(trifluoromethyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carbaldehyde (PubChem CID 82389818) has the molecular formula C10H9F3OS and a molecular weight of 234.24 g/mol. Its IUPAC name is 3-(trifluoromethyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carbaldehyde.
| Compound Name | 3-(trifluoromethyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carbaldehyde |
|---|---|
| PubChem CID | 82389818 |
| Molecular Formula | C10H9F3OS |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 3-(trifluoromethyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carbaldehyde |
| SMILES | O=Cc1sc(C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C10H9F3OS/c11-10(12,13)9-7-4-2-1-3-6(7)8(5-14)15-9/h5H,1-4H2 |
| InChIKey | JMNIXVZSTNQUNG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|