About 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine
6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine (PubChem CID 82390274) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine |
| PubChem CID | 82390274 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine |
| SMILES | CC1(C)CNCC(c2ccc3c(c2)OCC3)N1 |
| InChI | InChI=1S/C14H20N2O/c1-14(2)9-15-8-12(16-14)11-4-3-10-5-6-17-13(10)7-11/h3-4,7,12,15-16H,5-6,8-9H2,1-2H3 |
| InChIKey | HHXJKEOMRFRGTD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine?
The IUPAC name of 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine (CID 82390274) is 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine.
What is the SMILES notation for 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine?
The canonical SMILES for 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine is CC1(C)CNCC(c2ccc3c(c2)OCC3)N1.
What is the InChIKey of 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine?
The InChIKey is HHXJKEOMRFRGTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c1-14(2)9-15-8-12(16-14)11-4-3-10-5-6-17-13(10)7-11/h3-4,7,12,15-16H,5-6,8-9H2,1-2H3.
What are the key properties of 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine?
6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine has a molecular weight of 232.33 g/mol, XLogP of 1.63, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dihydro-1-benzofuran-6-yl)-2,2-dimethylpiperazine is sourced from PubChem (CID 82390274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).