About 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine
1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine (PubChem CID 82390487) has the molecular formula C8H10BrNS
and a molecular weight of 232.15 g/mol. Its IUPAC name is 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine.
Analyze 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine?
The IUPAC name of 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine (CID 82390487) is 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine.
What is the SMILES notation for 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine?
The canonical SMILES for 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine is Brc1scc2c1CCCNC2.
What is the InChIKey of 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine?
The InChIKey is QOJPOGKOFZCKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrNS/c9-8-7-2-1-3-10-4-6(7)5-11-8/h5,10H,1-4H2.
What are the key properties of 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine?
1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine has a molecular weight of 232.15 g/mol, XLogP of 2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine is sourced from PubChem (CID 82390487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).