About (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine
(6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine (PubChem CID 82390841) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine.
Molecular Properties
| Compound Name | (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine |
| PubChem CID | 82390841 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine |
| SMILES | NCC1CCC(c2cnc3ccccn23)NC1 |
| InChI | InChI=1S/C13H18N4/c14-7-10-4-5-11(15-8-10)12-9-16-13-3-1-2-6-17(12)13/h1-3,6,9-11,15H,4-5,7-8,14H2 |
| InChIKey | ZUWUMYMVADYWBG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine?
The IUPAC name of (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine (CID 82390841) is (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine.
What is the SMILES notation for (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine?
The canonical SMILES for (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine is NCC1CCC(c2cnc3ccccn23)NC1.
What is the InChIKey of (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine?
The InChIKey is ZUWUMYMVADYWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4/c14-7-10-4-5-11(15-8-10)12-9-16-13-3-1-2-6-17(12)13/h1-3,6,9-11,15H,4-5,7-8,14H2.
What are the key properties of (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine?
(6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine has a molecular weight of 230.31 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-imidazo[1,2-a]pyridin-3-ylpiperidin-3-yl)methanamine is sourced from PubChem (CID 82390841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).