About 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine
1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine (PubChem CID 82391415) has the molecular formula C9H11BrN2
and a molecular weight of 227.10 g/mol. Its IUPAC name is 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine.
Molecular Properties
| Compound Name | 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine |
| PubChem CID | 82391415 |
| Molecular Formula | C9H11BrN2 |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine |
| SMILES | CC1CCc2cnnc(Br)c2C1 |
| InChI | InChI=1S/C9H11BrN2/c1-6-2-3-7-5-11-12-9(10)8(7)4-6/h5-6H,2-4H2,1H3 |
| InChIKey | MAKZDCHFYNIASM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine?
The IUPAC name of 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine (CID 82391415) is 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine.
What is the SMILES notation for 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine?
The canonical SMILES for 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine is CC1CCc2cnnc(Br)c2C1.
What is the InChIKey of 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine?
The InChIKey is MAKZDCHFYNIASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN2/c1-6-2-3-7-5-11-12-9(10)8(7)4-6/h5-6H,2-4H2,1H3.
What are the key properties of 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine?
1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine has a molecular weight of 227.10 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-7-methyl-5,6,7,8-tetrahydrophthalazine is sourced from PubChem (CID 82391415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).