C10H18N4S — CID 82391463
3-(1-amino-2-methylpropan-2-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-2-thione (PubChem CID 82391463) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is 3-(1-amino-2-methylpropan-2-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-2-thione.
| Compound Name | 3-(1-amino-2-methylpropan-2-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-2-thione |
|---|---|
| PubChem CID | 82391463 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3-(1-amino-2-methylpropan-2-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-2-thione |
| SMILES | CC(C)(CN)n1c2c([nH]c1=S)CCNC2 |
| InChI | InChI=1S/C10H18N4S/c1-10(2,6-11)14-8-5-12-4-3-7(8)13-9(14)15/h12H,3-6,11H2,1-2H3,(H,13,15) |
| InChIKey | SONMYFSGROTZHQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|