About 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole
6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole (PubChem CID 82392082) has the molecular formula C12H15ClN2
and a molecular weight of 222.72 g/mol. Its IUPAC name is 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole |
| PubChem CID | 82392082 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole |
| SMILES | Clc1cc2c(cc1N1CCCC1)CCN2 |
| InChI | InChI=1S/C12H15ClN2/c13-10-8-11-9(3-4-14-11)7-12(10)15-5-1-2-6-15/h7-8,14H,1-6H2 |
| InChIKey | JYJQYIVZQNBRGG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole?
The IUPAC name of 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole (CID 82392082) is 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole.
What is the SMILES notation for 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole?
The canonical SMILES for 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole is Clc1cc2c(cc1N1CCCC1)CCN2.
What is the InChIKey of 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole?
The InChIKey is JYJQYIVZQNBRGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2/c13-10-8-11-9(3-4-14-11)7-12(10)15-5-1-2-6-15/h7-8,14H,1-6H2.
What are the key properties of 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole?
6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole has a molecular weight of 222.72 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-pyrrolidin-1-yl-2,3-dihydro-1H-indole is sourced from PubChem (CID 82392082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).