About 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid
2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid (PubChem CID 82392202) has the molecular formula C8H14O5S
and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid |
| PubChem CID | 82392202 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid |
| SMILES | COC1CS(=O)(=O)CCC1CC(=O)O |
| InChI | InChI=1S/C8H14O5S/c1-13-7-5-14(11,12)3-2-6(7)4-8(9)10/h6-7H,2-5H2,1H3,(H,9,10) |
| InChIKey | FJPSNOFRKITVGO-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid?
The IUPAC name of 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid (CID 82392202) is 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid.
What is the SMILES notation for 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid?
The canonical SMILES for 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid is COC1CS(=O)(=O)CCC1CC(=O)O.
What is the InChIKey of 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid?
The InChIKey is FJPSNOFRKITVGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5S/c1-13-7-5-14(11,12)3-2-6(7)4-8(9)10/h6-7H,2-5H2,1H3,(H,9,10).
What are the key properties of 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid?
2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid has a molecular weight of 222.26 g/mol, XLogP of -0.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxy-1,1-dioxothian-4-yl)acetic acid is sourced from PubChem (CID 82392202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).