C12H19N3O — CID 82392329
10-(aminomethyl)-1,9-dimethyl-2,3,4,5-tetrahydropyrido[1,2-a][1,3]diazepin-7-one (PubChem CID 82392329) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 10-(aminomethyl)-1,9-dimethyl-2,3,4,5-tetrahydropyrido[1,2-a][1,3]diazepin-7-one.
| Compound Name | 10-(aminomethyl)-1,9-dimethyl-2,3,4,5-tetrahydropyrido[1,2-a][1,3]diazepin-7-one |
|---|---|
| PubChem CID | 82392329 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 10-(aminomethyl)-1,9-dimethyl-2,3,4,5-tetrahydropyrido[1,2-a][1,3]diazepin-7-one |
| SMILES | Cc1cc(=O)n2c(c1CN)N(C)CCCC2 |
| InChI | InChI=1S/C12H19N3O/c1-9-7-11(16)15-6-4-3-5-14(2)12(15)10(9)8-13/h7H,3-6,8,13H2,1-2H3 |
| InChIKey | YVISNPCRSCZBSR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |