About 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde
2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde (PubChem CID 82392806) has the molecular formula C9H4N2O3S
and a molecular weight of 220.21 g/mol. Its IUPAC name is 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde |
| PubChem CID | 82392806 |
| Molecular Formula | C9H4N2O3S |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde |
| SMILES | O=Cc1occ2nc(-c3cscn3)oc12 |
| InChI | InChI=1S/C9H4N2O3S/c12-1-7-8-5(2-13-7)11-9(14-8)6-3-15-4-10-6/h1-4H |
| InChIKey | FQWKDZVPHFHFAN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde?
The IUPAC name of 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde (CID 82392806) is 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde.
What is the SMILES notation for 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde?
The canonical SMILES for 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde is O=Cc1occ2nc(-c3cscn3)oc12.
What is the InChIKey of 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde?
The InChIKey is FQWKDZVPHFHFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N2O3S/c12-1-7-8-5(2-13-7)11-9(14-8)6-3-15-4-10-6/h1-4H.
What are the key properties of 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde?
2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde has a molecular weight of 220.21 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-4-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde is sourced from PubChem (CID 82392806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).