(2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid

C13H17NO2 — CID 82392927

IUPAC(2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid
SMILESCc1ccc([C@H]2NCC[C@@H]2C(=O)O)c(C)c1
InChIInChI=1S/C13H17NO2/c1-8-3-4-10(9(2)7-8)12-11(13(15)16)5-6-14-12/h3-4,7,11-12,14H,5-6H2,1-2H3,(H,15,16)/t11-,12+/m0/s1
InChIKeyBNSZAPVKGQOISA-NWDGAFQWSA-N
MW219.28 g/mol
LogP2.04
Rot. Bonds2

About (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid

(2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 82392927) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name(2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid
PubChem CID82392927
Molecular FormulaC13H17NO2
Molecular Weight219.28 g/mol
Exact Mass219.13
IUPAC Name(2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid
SMILESCc1ccc([C@H]2NCC[C@@H]2C(=O)O)c(C)c1
InChIInChI=1S/C13H17NO2/c1-8-3-4-10(9(2)7-8)12-11(13(15)16)5-6-14-12/h3-4,7,11-12,14H,5-6H2,1-2H3,(H,15,16)/t11-,12+/m0/s1
InChIKeyBNSZAPVKGQOISA-NWDGAFQWSA-N
XLogP2.04
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.28
LogP ≤ 52.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid (CID 82392927) is (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid is Cc1ccc([C@H]2NCC[C@@H]2C(=O)O)c(C)c1.
What is the InChIKey of (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid?
The InChIKey is BNSZAPVKGQOISA-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H17NO2/c1-8-3-4-10(9(2)7-8)12-11(13(15)16)5-6-14-12/h3-4,7,11-12,14H,5-6H2,1-2H3,(H,15,16)/t11-,12+/m0/s1.
What are the key properties of (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid?
(2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid has a molecular weight of 219.28 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-(2,4-dimethylphenyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 82392927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).