About 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine
6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine (PubChem CID 82393141) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine |
| PubChem CID | 82393141 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine |
| SMILES | Cc1ccc(C2CNCC(C)(C)N2)cc1C |
| InChI | InChI=1S/C14H22N2/c1-10-5-6-12(7-11(10)2)13-8-15-9-14(3,4)16-13/h5-7,13,15-16H,8-9H2,1-4H3 |
| InChIKey | VRFISDKPKBCRCD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine?
The IUPAC name of 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine (CID 82393141) is 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine.
What is the SMILES notation for 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine?
The canonical SMILES for 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine is Cc1ccc(C2CNCC(C)(C)N2)cc1C.
What is the InChIKey of 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine?
The InChIKey is VRFISDKPKBCRCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2/c1-10-5-6-12(7-11(10)2)13-8-15-9-14(3,4)16-13/h5-7,13,15-16H,8-9H2,1-4H3.
What are the key properties of 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine?
6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine has a molecular weight of 218.34 g/mol, XLogP of 2.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dimethylphenyl)-2,2-dimethylpiperazine is sourced from PubChem (CID 82393141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).