C9H16N4S — CID 82394338
1-(3-aminopropyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-2-thione (PubChem CID 82394338) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 1-(3-aminopropyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-2-thione.
| Compound Name | 1-(3-aminopropyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-2-thione |
|---|---|
| PubChem CID | 82394338 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-(3-aminopropyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-2-thione |
| SMILES | NCCCn1c2c([nH]c1=S)CNCC2 |
| InChI | InChI=1S/C9H16N4S/c10-3-1-5-13-8-2-4-11-6-7(8)12-9(13)14/h11H,1-6,10H2,(H,12,14) |
| InChIKey | SLTQHNORGRWCHQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|