C10H10FNOS — CID 82394619
7-amino-9-fluoro-3,4-dihydro-2H-1-benzothiepin-5-one (PubChem CID 82394619) has the molecular formula C10H10FNOS and a molecular weight of 211.26 g/mol. Its IUPAC name is 7-amino-9-fluoro-3,4-dihydro-2H-1-benzothiepin-5-one.
| Compound Name | 7-amino-9-fluoro-3,4-dihydro-2H-1-benzothiepin-5-one |
|---|---|
| PubChem CID | 82394619 |
| Molecular Formula | C10H10FNOS |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 7-amino-9-fluoro-3,4-dihydro-2H-1-benzothiepin-5-one |
| SMILES | Nc1cc(F)c2c(c1)C(=O)CCCS2 |
| InChI | InChI=1S/C10H10FNOS/c11-8-5-6(12)4-7-9(13)2-1-3-14-10(7)8/h4-5H,1-3,12H2 |
| InChIKey | FXZWYIBKELGMDU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|