C12H23N3 — CID 82394990
2-methylspiro[3,6,7,8,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-4,1'-cyclopentane] (PubChem CID 82394990) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-methylspiro[3,6,7,8,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-4,1'-cyclopentane].
| Compound Name | 2-methylspiro[3,6,7,8,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-4,1'-cyclopentane] |
|---|---|
| PubChem CID | 82394990 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-methylspiro[3,6,7,8,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine-4,1'-cyclopentane] |
| SMILES | CN1CC2CNCCN2C2(CCCC2)C1 |
| InChI | InChI=1S/C12H23N3/c1-14-9-11-8-13-6-7-15(11)12(10-14)4-2-3-5-12/h11,13H,2-10H2,1H3 |
| InChIKey | LVYHHWWAMCLQSL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |