About 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione
6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione (PubChem CID 82395106) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione.
Molecular Properties
| Compound Name | 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione |
| PubChem CID | 82395106 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione |
| SMILES | O=C1NC2(CC2)C(=O)N1C1CCNCC1 |
| InChI | InChI=1S/C10H15N3O2/c14-8-10(3-4-10)12-9(15)13(8)7-1-5-11-6-2-7/h7,11H,1-6H2,(H,12,15) |
| InChIKey | DYTUCXSULPHXLJ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione?
The IUPAC name of 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione (CID 82395106) is 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione.
What is the SMILES notation for 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione?
The canonical SMILES for 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione is O=C1NC2(CC2)C(=O)N1C1CCNCC1.
What is the InChIKey of 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione?
The InChIKey is DYTUCXSULPHXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c14-8-10(3-4-10)12-9(15)13(8)7-1-5-11-6-2-7/h7,11H,1-6H2,(H,12,15).
What are the key properties of 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione?
6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione has a molecular weight of 209.25 g/mol, XLogP of -0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperidin-4-yl-4,6-diazaspiro[2.4]heptane-5,7-dione is sourced from PubChem (CID 82395106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).