2-(1,1,3-trioxothian-4-yl)acetic acid

C7H10O5S — CID 82396056

IUPAC2-(1,1,3-trioxothian-4-yl)acetic acid
SMILESO=C(O)CC1CCS(=O)(=O)CC1=O
InChIInChI=1S/C7H10O5S/c8-6-4-13(11,12)2-1-5(6)3-7(9)10/h5H,1-4H2,(H,9,10)
InChIKeyASMGXKDTLFJBJV-UHFFFAOYSA-N
MW206.22 g/mol
LogP-0.54
Rot. Bonds2

About 2-(1,1,3-trioxothian-4-yl)acetic acid

2-(1,1,3-trioxothian-4-yl)acetic acid (PubChem CID 82396056) has the molecular formula C7H10O5S and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-(1,1,3-trioxothian-4-yl)acetic acid.

Molecular Properties

Compound Name2-(1,1,3-trioxothian-4-yl)acetic acid
PubChem CID82396056
Molecular FormulaC7H10O5S
Molecular Weight206.22 g/mol
Exact Mass206.02
IUPAC Name2-(1,1,3-trioxothian-4-yl)acetic acid
SMILESO=C(O)CC1CCS(=O)(=O)CC1=O
InChIInChI=1S/C7H10O5S/c8-6-4-13(11,12)2-1-5(6)3-7(9)10/h5H,1-4H2,(H,9,10)
InChIKeyASMGXKDTLFJBJV-UHFFFAOYSA-N
XLogP-0.54
TPSA88.51 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.22
LogP ≤ 5-0.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,1,3-trioxothian-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1,3-trioxothian-4-yl)acetic acid?
The IUPAC name of 2-(1,1,3-trioxothian-4-yl)acetic acid (CID 82396056) is 2-(1,1,3-trioxothian-4-yl)acetic acid.
What is the SMILES notation for 2-(1,1,3-trioxothian-4-yl)acetic acid?
The canonical SMILES for 2-(1,1,3-trioxothian-4-yl)acetic acid is O=C(O)CC1CCS(=O)(=O)CC1=O.
What is the InChIKey of 2-(1,1,3-trioxothian-4-yl)acetic acid?
The InChIKey is ASMGXKDTLFJBJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5S/c8-6-4-13(11,12)2-1-5(6)3-7(9)10/h5H,1-4H2,(H,9,10).
What are the key properties of 2-(1,1,3-trioxothian-4-yl)acetic acid?
2-(1,1,3-trioxothian-4-yl)acetic acid has a molecular weight of 206.22 g/mol, XLogP of -0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1,3-trioxothian-4-yl)acetic acid is sourced from PubChem (CID 82396056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).