About 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole
2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole (PubChem CID 82396168) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole.
Molecular Properties
| Compound Name | 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole |
| PubChem CID | 82396168 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole |
| SMILES | CC1NCc2nn(C3CCCCC3)cc21 |
| InChI | InChI=1S/C12H19N3/c1-9-11-8-15(14-12(11)7-13-9)10-5-3-2-4-6-10/h8-10,13H,2-7H2,1H3 |
| InChIKey | NKDKVZFTDNUNNP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole?
The IUPAC name of 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole (CID 82396168) is 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole.
What is the SMILES notation for 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole?
The canonical SMILES for 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole is CC1NCc2nn(C3CCCCC3)cc21.
What is the InChIKey of 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole?
The InChIKey is NKDKVZFTDNUNNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-9-11-8-15(14-12(11)7-13-9)10-5-3-2-4-6-10/h8-10,13H,2-7H2,1H3.
What are the key properties of 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole?
2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole has a molecular weight of 205.31 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-4-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole is sourced from PubChem (CID 82396168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).