C12H15NO2 — CID 82396268
1,6,6-trimethyl-4-oxo-5,7-dihydroindole-2-carbaldehyde (PubChem CID 82396268) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1,6,6-trimethyl-4-oxo-5,7-dihydroindole-2-carbaldehyde.
| Compound Name | 1,6,6-trimethyl-4-oxo-5,7-dihydroindole-2-carbaldehyde |
|---|---|
| PubChem CID | 82396268 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1,6,6-trimethyl-4-oxo-5,7-dihydroindole-2-carbaldehyde |
| SMILES | Cn1c(C=O)cc2c1CC(C)(C)CC2=O |
| InChI | InChI=1S/C12H15NO2/c1-12(2)5-10-9(11(15)6-12)4-8(7-14)13(10)3/h4,7H,5-6H2,1-3H3 |
| InChIKey | SUCIYOJJSRDYSL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|