About 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one
6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one (PubChem CID 82396270) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one.
Molecular Properties
| Compound Name | 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one |
| PubChem CID | 82396270 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one |
| SMILES | CCOc1ccc2c(c1)C(=O)CCN2C |
| InChI | InChI=1S/C12H15NO2/c1-3-15-9-4-5-11-10(8-9)12(14)6-7-13(11)2/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | FMNTZKYZOGRIFR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one?
The IUPAC name of 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one (CID 82396270) is 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one.
What is the SMILES notation for 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one?
The canonical SMILES for 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one is CCOc1ccc2c(c1)C(=O)CCN2C.
What is the InChIKey of 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one?
The InChIKey is FMNTZKYZOGRIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-3-15-9-4-5-11-10(8-9)12(14)6-7-13(11)2/h4-5,8H,3,6-7H2,1-2H3.
What are the key properties of 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one?
6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one has a molecular weight of 205.26 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-1-methyl-2,3-dihydroquinolin-4-one is sourced from PubChem (CID 82396270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).