About 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile
5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile (PubChem CID 82396318) has the molecular formula C9H7N3OS
and a molecular weight of 205.24 g/mol. Its IUPAC name is 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile |
| PubChem CID | 82396318 |
| Molecular Formula | C9H7N3OS |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile |
| SMILES | Cc1cc2nsc(C#N)c2c(=O)n1C |
| InChI | InChI=1S/C9H7N3OS/c1-5-3-6-8(9(13)12(5)2)7(4-10)14-11-6/h3H,1-2H3 |
| InChIKey | QWHNYTBFGBUWKU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile?
The IUPAC name of 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile (CID 82396318) is 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile.
What is the SMILES notation for 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile?
The canonical SMILES for 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile is Cc1cc2nsc(C#N)c2c(=O)n1C.
What is the InChIKey of 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile?
The InChIKey is QWHNYTBFGBUWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3OS/c1-5-3-6-8(9(13)12(5)2)7(4-10)14-11-6/h3H,1-2H3.
What are the key properties of 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile?
5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile has a molecular weight of 205.24 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-4-oxo-[1,2]thiazolo[4,3-c]pyridine-3-carbonitrile is sourced from PubChem (CID 82396318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).