About 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline
4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline (PubChem CID 82396466) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline |
| PubChem CID | 82396466 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2(CCN)CC2)cc1 |
| InChI | InChI=1S/C13H20N2/c1-15(2)12-5-3-11(4-6-12)13(7-8-13)9-10-14/h3-6H,7-10,14H2,1-2H3 |
| InChIKey | VDEHVVVNRCVOLJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline?
The IUPAC name of 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline (CID 82396466) is 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline?
The canonical SMILES for 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline is CN(C)c1ccc(C2(CCN)CC2)cc1.
What is the InChIKey of 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline?
The InChIKey is VDEHVVVNRCVOLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-15(2)12-5-3-11(4-6-12)13(7-8-13)9-10-14/h3-6H,7-10,14H2,1-2H3.
What are the key properties of 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline?
4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline has a molecular weight of 204.32 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2-aminoethyl)cyclopropyl]-N,N-dimethylaniline is sourced from PubChem (CID 82396466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).