About (2S,5S)-5-benzyl-1,2-dimethylpiperazine
(2S,5S)-5-benzyl-1,2-dimethylpiperazine (PubChem CID 82396489) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is (2S,5S)-5-benzyl-1,2-dimethylpiperazine.
Molecular Properties
| Compound Name | (2S,5S)-5-benzyl-1,2-dimethylpiperazine |
| PubChem CID | 82396489 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2S,5S)-5-benzyl-1,2-dimethylpiperazine |
| SMILES | C[C@H]1CN[C@@H](Cc2ccccc2)CN1C |
| InChI | InChI=1S/C13H20N2/c1-11-9-14-13(10-15(11)2)8-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | RZDCZPXZPIPHAJ-AAEUAGOBSA-N |
| XLogP | 1.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,5S)-5-benzyl-1,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-5-benzyl-1,2-dimethylpiperazine?
The IUPAC name of (2S,5S)-5-benzyl-1,2-dimethylpiperazine (CID 82396489) is (2S,5S)-5-benzyl-1,2-dimethylpiperazine.
What is the SMILES notation for (2S,5S)-5-benzyl-1,2-dimethylpiperazine?
The canonical SMILES for (2S,5S)-5-benzyl-1,2-dimethylpiperazine is C[C@H]1CN[C@@H](Cc2ccccc2)CN1C.
What is the InChIKey of (2S,5S)-5-benzyl-1,2-dimethylpiperazine?
The InChIKey is RZDCZPXZPIPHAJ-AAEUAGOBSA-N. The full InChI is InChI=1S/C13H20N2/c1-11-9-14-13(10-15(11)2)8-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10H2,1-2H3/t11-,13-/m0/s1.
What are the key properties of (2S,5S)-5-benzyl-1,2-dimethylpiperazine?
(2S,5S)-5-benzyl-1,2-dimethylpiperazine has a molecular weight of 204.32 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-5-benzyl-1,2-dimethylpiperazine is sourced from PubChem (CID 82396489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).