C12H16N2O — CID 82396575
7-(dimethylamino)-1,2,3,5-tetrahydro-1-benzazepin-4-one (PubChem CID 82396575) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 7-(dimethylamino)-1,2,3,5-tetrahydro-1-benzazepin-4-one.
| Compound Name | 7-(dimethylamino)-1,2,3,5-tetrahydro-1-benzazepin-4-one |
|---|---|
| PubChem CID | 82396575 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 7-(dimethylamino)-1,2,3,5-tetrahydro-1-benzazepin-4-one |
| SMILES | CN(C)c1ccc2c(c1)CC(=O)CCN2 |
| InChI | InChI=1S/C12H16N2O/c1-14(2)10-3-4-12-9(7-10)8-11(15)5-6-13-12/h3-4,7,13H,5-6,8H2,1-2H3 |
| InChIKey | KCWAGJOZLDBDQV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|