C10H8N2O3 — CID 82396748
4-(3-methyl-1,2-oxazole-4-carbonyl)-1H-pyrrole-2-carbaldehyde (PubChem CID 82396748) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 4-(3-methyl-1,2-oxazole-4-carbonyl)-1H-pyrrole-2-carbaldehyde.
| Compound Name | 4-(3-methyl-1,2-oxazole-4-carbonyl)-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 82396748 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 4-(3-methyl-1,2-oxazole-4-carbonyl)-1H-pyrrole-2-carbaldehyde |
| SMILES | Cc1nocc1C(=O)c1c[nH]c(C=O)c1 |
| InChI | InChI=1S/C10H8N2O3/c1-6-9(5-15-12-6)10(14)7-2-8(4-13)11-3-7/h2-5,11H,1H3 |
| InChIKey | VJEPDOPGFBFLTR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|