About 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine
2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine (PubChem CID 82396769) has the molecular formula C6H3F3N4O
and a molecular weight of 204.11 g/mol. Its IUPAC name is 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine |
| PubChem CID | 82396769 |
| Molecular Formula | C6H3F3N4O |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine |
| SMILES | Nc1ncnc2oc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C6H3F3N4O/c7-6(8,9)5-13-2-3(10)11-1-12-4(2)14-5/h1H,(H2,10,11,12) |
| InChIKey | ACYMROLATUKMSA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The IUPAC name of 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine (CID 82396769) is 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine.
What is the SMILES notation for 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The canonical SMILES for 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine is Nc1ncnc2oc(C(F)(F)F)nc12.
What is the InChIKey of 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The InChIKey is ACYMROLATUKMSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3N4O/c7-6(8,9)5-13-2-3(10)11-1-12-4(2)14-5/h1H,(H2,10,11,12).
What are the key properties of 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine has a molecular weight of 204.11 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine is sourced from PubChem (CID 82396769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).