About 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline
5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline (PubChem CID 82397738) has the molecular formula C12H13N3
and a molecular weight of 199.26 g/mol. Its IUPAC name is 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline.
Molecular Properties
| Compound Name | 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline |
| PubChem CID | 82397738 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline |
| SMILES | CCc1cccc2c1Nc1cn[nH]c1C2 |
| InChI | InChI=1S/C12H13N3/c1-2-8-4-3-5-9-6-10-11(7-13-15-10)14-12(8)9/h3-5,7,14H,2,6H2,1H3,(H,13,15) |
| InChIKey | ZAQOKJDJMZBPBN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline?
The IUPAC name of 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline (CID 82397738) is 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline.
What is the SMILES notation for 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline?
The canonical SMILES for 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline is CCc1cccc2c1Nc1cn[nH]c1C2.
What is the InChIKey of 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline?
The InChIKey is ZAQOKJDJMZBPBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3/c1-2-8-4-3-5-9-6-10-11(7-13-15-10)14-12(8)9/h3-5,7,14H,2,6H2,1H3,(H,13,15).
What are the key properties of 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline?
5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline has a molecular weight of 199.26 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4,9-dihydro-1H-pyrazolo[4,5-b]quinoline is sourced from PubChem (CID 82397738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).