About 5-bromo-1,2,3-benzoxadiazole
5-bromo-1,2,3-benzoxadiazole (PubChem CID 82397990) has the molecular formula C6H3BrN2O
and a molecular weight of 199.01 g/mol. Its IUPAC name is 5-bromo-1,2,3-benzoxadiazole.
Molecular Properties
| Compound Name | 5-bromo-1,2,3-benzoxadiazole |
| PubChem CID | 82397990 |
| Molecular Formula | C6H3BrN2O |
| Molecular Weight | 199.01 g/mol |
| Exact Mass | 197.94 |
| IUPAC Name | 5-bromo-1,2,3-benzoxadiazole |
| SMILES | Brc1ccc2onnc2c1 |
| InChI | InChI=1S/C6H3BrN2O/c7-4-1-2-6-5(3-4)8-9-10-6/h1-3H |
| InChIKey | PHJJTETWCBBLGZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.01 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-1,2,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,2,3-benzoxadiazole?
The IUPAC name of 5-bromo-1,2,3-benzoxadiazole (CID 82397990) is 5-bromo-1,2,3-benzoxadiazole.
What is the SMILES notation for 5-bromo-1,2,3-benzoxadiazole?
The canonical SMILES for 5-bromo-1,2,3-benzoxadiazole is Brc1ccc2onnc2c1.
What is the InChIKey of 5-bromo-1,2,3-benzoxadiazole?
The InChIKey is PHJJTETWCBBLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrN2O/c7-4-1-2-6-5(3-4)8-9-10-6/h1-3H.
What are the key properties of 5-bromo-1,2,3-benzoxadiazole?
5-bromo-1,2,3-benzoxadiazole has a molecular weight of 199.01 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,2,3-benzoxadiazole is sourced from PubChem (CID 82397990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).