C8H14N4S — CID 82398116
1-(2-aminoethyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-2-thione (PubChem CID 82398116) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-(2-aminoethyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-2-thione.
| Compound Name | 1-(2-aminoethyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-2-thione |
|---|---|
| PubChem CID | 82398116 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-(2-aminoethyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-2-thione |
| SMILES | NCCn1c2c([nH]c1=S)CNCC2 |
| InChI | InChI=1S/C8H14N4S/c9-2-4-12-7-1-3-10-5-6(7)11-8(12)13/h10H,1-5,9H2,(H,11,13) |
| InChIKey | CUQWLAYEQMFYMU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|