About furo[2,3-h]isoquinolin-1-ylmethanamine
furo[2,3-h]isoquinolin-1-ylmethanamine (PubChem CID 82398400) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is furo[2,3-h]isoquinolin-1-ylmethanamine.
Molecular Properties
| Compound Name | furo[2,3-h]isoquinolin-1-ylmethanamine |
| PubChem CID | 82398400 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | furo[2,3-h]isoquinolin-1-ylmethanamine |
| SMILES | NCc1nccc2ccc3occc3c12 |
| InChI | InChI=1S/C12H10N2O/c13-7-10-12-8(3-5-14-10)1-2-11-9(12)4-6-15-11/h1-6H,7,13H2 |
| InChIKey | BFQPFKAKDKQAJF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furo[2,3-h]isoquinolin-1-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[2,3-h]isoquinolin-1-ylmethanamine?
The IUPAC name of furo[2,3-h]isoquinolin-1-ylmethanamine (CID 82398400) is furo[2,3-h]isoquinolin-1-ylmethanamine.
What is the SMILES notation for furo[2,3-h]isoquinolin-1-ylmethanamine?
The canonical SMILES for furo[2,3-h]isoquinolin-1-ylmethanamine is NCc1nccc2ccc3occc3c12.
What is the InChIKey of furo[2,3-h]isoquinolin-1-ylmethanamine?
The InChIKey is BFQPFKAKDKQAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c13-7-10-12-8(3-5-14-10)1-2-11-9(12)4-6-15-11/h1-6H,7,13H2.
What are the key properties of furo[2,3-h]isoquinolin-1-ylmethanamine?
furo[2,3-h]isoquinolin-1-ylmethanamine has a molecular weight of 198.22 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[2,3-h]isoquinolin-1-ylmethanamine is sourced from PubChem (CID 82398400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).