About 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid
3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid (PubChem CID 82398437) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid.
Molecular Properties
| Compound Name | 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid |
| PubChem CID | 82398437 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid |
| SMILES | Cc1nn(C)cc1C(C)(O)CC(=O)O |
| InChI | InChI=1S/C9H14N2O3/c1-6-7(5-11(3)10-6)9(2,14)4-8(12)13/h5,14H,4H2,1-3H3,(H,12,13) |
| InChIKey | VINSPICBNPBSPW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid?
The IUPAC name of 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid (CID 82398437) is 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid.
What is the SMILES notation for 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid?
The canonical SMILES for 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid is Cc1nn(C)cc1C(C)(O)CC(=O)O.
What is the InChIKey of 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid?
The InChIKey is VINSPICBNPBSPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-6-7(5-11(3)10-6)9(2,14)4-8(12)13/h5,14H,4H2,1-3H3,(H,12,13).
What are the key properties of 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid?
3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid has a molecular weight of 198.22 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dimethylpyrazol-4-yl)-3-hydroxybutanoic acid is sourced from PubChem (CID 82398437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).