About 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine
1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine (PubChem CID 82398619) has the molecular formula C9H15N3S
and a molecular weight of 197.31 g/mol. Its IUPAC name is 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine.
Molecular Properties
| Compound Name | 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine |
| PubChem CID | 82398619 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine |
| SMILES | CN1CC(N)CC(c2cncs2)C1 |
| InChI | InChI=1S/C9H15N3S/c1-12-4-7(2-8(10)5-12)9-3-11-6-13-9/h3,6-8H,2,4-5,10H2,1H3 |
| InChIKey | GJUIXZQFKIHDJP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine?
The IUPAC name of 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine (CID 82398619) is 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine.
What is the SMILES notation for 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine?
The canonical SMILES for 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine is CN1CC(N)CC(c2cncs2)C1.
What is the InChIKey of 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine?
The InChIKey is GJUIXZQFKIHDJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S/c1-12-4-7(2-8(10)5-12)9-3-11-6-13-9/h3,6-8H,2,4-5,10H2,1H3.
What are the key properties of 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine?
1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine has a molecular weight of 197.31 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-(1,3-thiazol-5-yl)piperidin-3-amine is sourced from PubChem (CID 82398619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).