2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid

C9H11NO2S — CID 82398858

IUPAC2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid
SMILESO=C(O)CC1NCCc2ccsc21
InChIInChI=1S/C9H11NO2S/c11-8(12)5-7-9-6(1-3-10-7)2-4-13-9/h2,4,7,10H,1,3,5H2,(H,11,12)
InChIKeyIJUOCKYHXVURBS-UHFFFAOYSA-N
MW197.26 g/mol
LogP1.41
Rot. Bonds2

About 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid

2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid (PubChem CID 82398858) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid.

Molecular Properties

Compound Name2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid
PubChem CID82398858
Molecular FormulaC9H11NO2S
Molecular Weight197.26 g/mol
Exact Mass197.05
IUPAC Name2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid
SMILESO=C(O)CC1NCCc2ccsc21
InChIInChI=1S/C9H11NO2S/c11-8(12)5-7-9-6(1-3-10-7)2-4-13-9/h2,4,7,10H,1,3,5H2,(H,11,12)
InChIKeyIJUOCKYHXVURBS-UHFFFAOYSA-N
XLogP1.41
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.26
LogP ≤ 51.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid?
The IUPAC name of 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid (CID 82398858) is 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid.
What is the SMILES notation for 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid?
The canonical SMILES for 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid is O=C(O)CC1NCCc2ccsc21.
What is the InChIKey of 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid?
The InChIKey is IJUOCKYHXVURBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c11-8(12)5-7-9-6(1-3-10-7)2-4-13-9/h2,4,7,10H,1,3,5H2,(H,11,12).
What are the key properties of 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid?
2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid has a molecular weight of 197.26 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5,6,7-tetrahydrothieno[2,3-c]pyridin-7-yl)acetic acid is sourced from PubChem (CID 82398858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).