About 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol
4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol (PubChem CID 82398918) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol |
| PubChem CID | 82398918 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol |
| SMILES | NC(c1cnco1)C1(O)CCNCC1 |
| InChI | InChI=1S/C9H15N3O2/c10-8(7-5-12-6-14-7)9(13)1-3-11-4-2-9/h5-6,8,11,13H,1-4,10H2 |
| InChIKey | TTXUPQZPKXNVMX-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol?
The IUPAC name of 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol (CID 82398918) is 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol.
What is the SMILES notation for 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol?
The canonical SMILES for 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol is NC(c1cnco1)C1(O)CCNCC1.
What is the InChIKey of 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol?
The InChIKey is TTXUPQZPKXNVMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c10-8(7-5-12-6-14-7)9(13)1-3-11-4-2-9/h5-6,8,11,13H,1-4,10H2.
What are the key properties of 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol?
4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol has a molecular weight of 197.24 g/mol, XLogP of -0.21, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[amino(1,3-oxazol-5-yl)methyl]piperidin-4-ol is sourced from PubChem (CID 82398918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).