About 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid
2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid (PubChem CID 82399030) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid |
| PubChem CID | 82399030 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid |
| SMILES | Cc1cc(C(C)(O)C(=O)O)n(C)c1C |
| InChI | InChI=1S/C10H15NO3/c1-6-5-8(11(4)7(6)2)10(3,14)9(12)13/h5,14H,1-4H3,(H,12,13) |
| InChIKey | WKEOHODTRJBHHH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid?
The IUPAC name of 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid (CID 82399030) is 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid.
What is the SMILES notation for 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid?
The canonical SMILES for 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid is Cc1cc(C(C)(O)C(=O)O)n(C)c1C.
What is the InChIKey of 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid?
The InChIKey is WKEOHODTRJBHHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-6-5-8(11(4)7(6)2)10(3,14)9(12)13/h5,14H,1-4H3,(H,12,13).
What are the key properties of 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid?
2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid has a molecular weight of 197.23 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(1,4,5-trimethylpyrrol-2-yl)propanoic acid is sourced from PubChem (CID 82399030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).