About 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one
6-amino-8-fluoro-2,3-dihydrothiochromen-4-one (PubChem CID 82399035) has the molecular formula C9H8FNOS
and a molecular weight of 197.23 g/mol. Its IUPAC name is 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one.
Molecular Properties
| Compound Name | 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one |
| PubChem CID | 82399035 |
| Molecular Formula | C9H8FNOS |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one |
| SMILES | Nc1cc(F)c2c(c1)C(=O)CCS2 |
| InChI | InChI=1S/C9H8FNOS/c10-7-4-5(11)3-6-8(12)1-2-13-9(6)7/h3-4H,1-2,11H2 |
| InChIKey | QOHPUXTYGKKXOX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one?
The IUPAC name of 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one (CID 82399035) is 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one.
What is the SMILES notation for 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one?
The canonical SMILES for 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one is Nc1cc(F)c2c(c1)C(=O)CCS2.
What is the InChIKey of 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one?
The InChIKey is QOHPUXTYGKKXOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNOS/c10-7-4-5(11)3-6-8(12)1-2-13-9(6)7/h3-4H,1-2,11H2.
What are the key properties of 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one?
6-amino-8-fluoro-2,3-dihydrothiochromen-4-one has a molecular weight of 197.23 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-8-fluoro-2,3-dihydrothiochromen-4-one is sourced from PubChem (CID 82399035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).