About 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide
5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide (PubChem CID 82399128) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 82399128 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide |
| SMILES | CC(=O)c1onc(C(=O)N(C)C)c1N |
| InChI | InChI=1S/C8H11N3O3/c1-4(12)7-5(9)6(10-14-7)8(13)11(2)3/h9H2,1-3H3 |
| InChIKey | BEYRKIIDZZAJNV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide (CID 82399128) is 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide is CC(=O)c1onc(C(=O)N(C)C)c1N.
What is the InChIKey of 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide?
The InChIKey is BEYRKIIDZZAJNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-4(12)7-5(9)6(10-14-7)8(13)11(2)3/h9H2,1-3H3.
What are the key properties of 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide?
5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide has a molecular weight of 197.19 g/mol, XLogP of 0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-4-amino-N,N-dimethyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 82399128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).