About 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione
3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione (PubChem CID 82399630) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione.
Analyze 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione?
The IUPAC name of 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione (CID 82399630) is 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione.
What is the SMILES notation for 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione?
The canonical SMILES for 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione is Cc1nsc2c1C(=O)CN(C)C2=O.
What is the InChIKey of 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione?
The InChIKey is NIRXZVVUTAHZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c1-4-6-5(11)3-10(2)8(12)7(6)13-9-4/h3H2,1-2H3.
What are the key properties of 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione?
3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione has a molecular weight of 196.23 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-5H-[1,2]thiazolo[5,4-c]pyridine-4,7-dione is sourced from PubChem (CID 82399630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).