About 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine
5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine (PubChem CID 82399913) has the molecular formula C7H6ClN5
and a molecular weight of 195.61 g/mol. Its IUPAC name is 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine.
Molecular Properties
| Compound Name | 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine |
| PubChem CID | 82399913 |
| Molecular Formula | C7H6ClN5 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine |
| SMILES | Cc1cc2c(Cl)nc(N)nc2nn1 |
| InChI | InChI=1S/C7H6ClN5/c1-3-2-4-5(8)10-7(9)11-6(4)13-12-3/h2H,1H3,(H2,9,10,11,13) |
| InChIKey | YVJWSSUQWKQGGG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine?
The IUPAC name of 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine (CID 82399913) is 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine.
What is the SMILES notation for 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine?
The canonical SMILES for 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine is Cc1cc2c(Cl)nc(N)nc2nn1.
What is the InChIKey of 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine?
The InChIKey is YVJWSSUQWKQGGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN5/c1-3-2-4-5(8)10-7(9)11-6(4)13-12-3/h2H,1H3,(H2,9,10,11,13).
What are the key properties of 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine?
5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine has a molecular weight of 195.61 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-methylpyrimido[4,5-c]pyridazin-7-amine is sourced from PubChem (CID 82399913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).