3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid

C10H13NO3 — CID 82400539

IUPAC3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid
SMILESCc1nc(C2CC2)oc1CCC(=O)O
InChIInChI=1S/C10H13NO3/c1-6-8(4-5-9(12)13)14-10(11-6)7-2-3-7/h7H,2-5H2,1H3,(H,12,13)
InChIKeyOTKHQLIYJAKUNS-UHFFFAOYSA-N
MW195.22 g/mol
LogP1.88
Rot. Bonds4

About 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid

3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid (PubChem CID 82400539) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid.

Molecular Properties

Compound Name3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid
PubChem CID82400539
Molecular FormulaC10H13NO3
Molecular Weight195.22 g/mol
Exact Mass195.09
IUPAC Name3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid
SMILESCc1nc(C2CC2)oc1CCC(=O)O
InChIInChI=1S/C10H13NO3/c1-6-8(4-5-9(12)13)14-10(11-6)7-2-3-7/h7H,2-5H2,1H3,(H,12,13)
InChIKeyOTKHQLIYJAKUNS-UHFFFAOYSA-N
XLogP1.88
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.22
LogP ≤ 51.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid?
The IUPAC name of 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid (CID 82400539) is 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid.
What is the SMILES notation for 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid?
The canonical SMILES for 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid is Cc1nc(C2CC2)oc1CCC(=O)O.
What is the InChIKey of 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid?
The InChIKey is OTKHQLIYJAKUNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-6-8(4-5-9(12)13)14-10(11-6)7-2-3-7/h7H,2-5H2,1H3,(H,12,13).
What are the key properties of 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid?
3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid has a molecular weight of 195.22 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)propanoic acid is sourced from PubChem (CID 82400539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).