About 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid
5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid (PubChem CID 82400624) has the molecular formula C7H5N3O2S
and a molecular weight of 195.20 g/mol. Its IUPAC name is 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid.
Molecular Properties
| Compound Name | 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid |
| PubChem CID | 82400624 |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid |
| SMILES | Nc1sc(C(=O)O)c2ncncc12 |
| InChI | InChI=1S/C7H5N3O2S/c8-6-3-1-9-2-10-4(3)5(13-6)7(11)12/h1-2H,8H2,(H,11,12) |
| InChIKey | ACJZPCXKMMERIU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid?
The IUPAC name of 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid (CID 82400624) is 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid.
What is the SMILES notation for 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid?
The canonical SMILES for 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid is Nc1sc(C(=O)O)c2ncncc12.
What is the InChIKey of 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid?
The InChIKey is ACJZPCXKMMERIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2S/c8-6-3-1-9-2-10-4(3)5(13-6)7(11)12/h1-2H,8H2,(H,11,12).
What are the key properties of 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid?
5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid has a molecular weight of 195.20 g/mol, XLogP of 0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminothieno[3,4-d]pyrimidine-7-carboxylic acid is sourced from PubChem (CID 82400624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).