About 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid
5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid (PubChem CID 82400656) has the molecular formula C8H9N3O3
and a molecular weight of 195.18 g/mol. Its IUPAC name is 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid |
| PubChem CID | 82400656 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid |
| SMILES | CC(=O)N1Cc2nc(C(=O)O)[nH]c2C1 |
| InChI | InChI=1S/C8H9N3O3/c1-4(12)11-2-5-6(3-11)10-7(9-5)8(13)14/h2-3H2,1H3,(H,9,10)(H,13,14) |
| InChIKey | OJXXMYXXJYNJCG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid?
The IUPAC name of 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid (CID 82400656) is 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid.
What is the SMILES notation for 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid?
The canonical SMILES for 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid is CC(=O)N1Cc2nc(C(=O)O)[nH]c2C1.
What is the InChIKey of 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid?
The InChIKey is OJXXMYXXJYNJCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3/c1-4(12)11-2-5-6(3-11)10-7(9-5)8(13)14/h2-3H2,1H3,(H,9,10)(H,13,14).
What are the key properties of 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid?
5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid has a molecular weight of 195.18 g/mol, XLogP of -0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-4,6-dihydro-1H-pyrrolo[3,4-d]imidazole-2-carboxylic acid is sourced from PubChem (CID 82400656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).