About 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid
4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid (PubChem CID 82401217) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid.
Analyze 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid?
The IUPAC name of 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid (CID 82401217) is 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid.
What is the SMILES notation for 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid?
The canonical SMILES for 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid is O=C(O)CCCc1n[nH]c2c1CCC2.
What is the InChIKey of 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid?
The InChIKey is QBYAHOQZOMPUTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c13-10(14)6-2-5-9-7-3-1-4-8(7)11-12-9/h1-6H2,(H,11,12)(H,13,14).
What are the key properties of 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid?
4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid has a molecular weight of 194.23 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)butanoic acid is sourced from PubChem (CID 82401217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).