C10H11FN2O — CID 82401372
1-(8-fluoro-3,4-dihydro-2H-quinoxalin-1-yl)ethanone (PubChem CID 82401372) has the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. Its IUPAC name is 1-(8-fluoro-3,4-dihydro-2H-quinoxalin-1-yl)ethanone.
| Compound Name | 1-(8-fluoro-3,4-dihydro-2H-quinoxalin-1-yl)ethanone |
|---|---|
| PubChem CID | 82401372 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-(8-fluoro-3,4-dihydro-2H-quinoxalin-1-yl)ethanone |
| SMILES | CC(=O)N1CCNc2cccc(F)c21 |
| InChI | InChI=1S/C10H11FN2O/c1-7(14)13-6-5-12-9-4-2-3-8(11)10(9)13/h2-4,12H,5-6H2,1H3 |
| InChIKey | WSIFLUHLZXASBK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |