About 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one
2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one (PubChem CID 82401396) has the molecular formula C8H10N4O2
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one |
| PubChem CID | 82401396 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one |
| SMILES | COc1nc(CN)nc2c1CNC2=O |
| InChI | InChI=1S/C8H10N4O2/c1-14-8-4-3-10-7(13)6(4)11-5(2-9)12-8/h2-3,9H2,1H3,(H,10,13) |
| InChIKey | BPJGIRGRTAKFOJ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one?
The IUPAC name of 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one (CID 82401396) is 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one.
What is the SMILES notation for 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one?
The canonical SMILES for 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one is COc1nc(CN)nc2c1CNC2=O.
What is the InChIKey of 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one?
The InChIKey is BPJGIRGRTAKFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2/c1-14-8-4-3-10-7(13)6(4)11-5(2-9)12-8/h2-3,9H2,1H3,(H,10,13).
What are the key properties of 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one?
2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one has a molecular weight of 194.19 g/mol, XLogP of -0.81, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-4-methoxy-5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one is sourced from PubChem (CID 82401396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).