6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid

C8H7N3O3 — CID 82402345

IUPAC6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid
SMILESCc1noc2nc(N)c(C(=O)O)cc12
InChIInChI=1S/C8H7N3O3/c1-3-4-2-5(8(12)13)6(9)10-7(4)14-11-3/h2H,1H3,(H2,9,10)(H,12,13)
InChIKeySERHUZOXXZNECZ-UHFFFAOYSA-N
MW193.16 g/mol
LogP0.81
Rot. Bonds1

About 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid

6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid (PubChem CID 82402345) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid.

Molecular Properties

Compound Name6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid
PubChem CID82402345
Molecular FormulaC8H7N3O3
Molecular Weight193.16 g/mol
Exact Mass193.05
IUPAC Name6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid
SMILESCc1noc2nc(N)c(C(=O)O)cc12
InChIInChI=1S/C8H7N3O3/c1-3-4-2-5(8(12)13)6(9)10-7(4)14-11-3/h2H,1H3,(H2,9,10)(H,12,13)
InChIKeySERHUZOXXZNECZ-UHFFFAOYSA-N
XLogP0.81
TPSA102.24 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.16
LogP ≤ 50.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid?
The IUPAC name of 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid (CID 82402345) is 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid.
What is the SMILES notation for 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid?
The canonical SMILES for 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid is Cc1noc2nc(N)c(C(=O)O)cc12.
What is the InChIKey of 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid?
The InChIKey is SERHUZOXXZNECZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3/c1-3-4-2-5(8(12)13)6(9)10-7(4)14-11-3/h2H,1H3,(H2,9,10)(H,12,13).
What are the key properties of 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid?
6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid has a molecular weight of 193.16 g/mol, XLogP of 0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid is sourced from PubChem (CID 82402345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).