C12H20N2 — CID 82402430
3-(2-aminoethyl)-N,N-diethylaniline (PubChem CID 82402430) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 3-(2-aminoethyl)-N,N-diethylaniline.
| Compound Name | 3-(2-aminoethyl)-N,N-diethylaniline |
|---|---|
| PubChem CID | 82402430 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3-(2-aminoethyl)-N,N-diethylaniline |
| SMILES | CCN(CC)c1cccc(CCN)c1 |
| InChI | InChI=1S/C12H20N2/c1-3-14(4-2)12-7-5-6-11(10-12)8-9-13/h5-7,10H,3-4,8-9,13H2,1-2H3 |
| InChIKey | WAVQKQMRLIHCFW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |