8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid

C10H12N2O2 — CID 82402785

IUPAC8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid
SMILESCc1cncc2c1C(C(=O)O)NCC2
InChIInChI=1S/C10H12N2O2/c1-6-4-11-5-7-2-3-12-9(8(6)7)10(13)14/h4-5,9,12H,2-3H2,1H3,(H,13,14)
InChIKeyUPYVXQVLCPWNIR-UHFFFAOYSA-N
MW192.22 g/mol
LogP0.66
Rot. Bonds1

About 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid

8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid (PubChem CID 82402785) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid.

Molecular Properties

Compound Name8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid
PubChem CID82402785
Molecular FormulaC10H12N2O2
Molecular Weight192.22 g/mol
Exact Mass192.09
IUPAC Name8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid
SMILESCc1cncc2c1C(C(=O)O)NCC2
InChIInChI=1S/C10H12N2O2/c1-6-4-11-5-7-2-3-12-9(8(6)7)10(13)14/h4-5,9,12H,2-3H2,1H3,(H,13,14)
InChIKeyUPYVXQVLCPWNIR-UHFFFAOYSA-N
XLogP0.66
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.22
LogP ≤ 50.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid?
The IUPAC name of 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid (CID 82402785) is 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid.
What is the SMILES notation for 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid?
The canonical SMILES for 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid is Cc1cncc2c1C(C(=O)O)NCC2.
What is the InChIKey of 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid?
The InChIKey is UPYVXQVLCPWNIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-6-4-11-5-7-2-3-12-9(8(6)7)10(13)14/h4-5,9,12H,2-3H2,1H3,(H,13,14).
What are the key properties of 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid?
8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid has a molecular weight of 192.22 g/mol, XLogP of 0.66, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-1-carboxylic acid is sourced from PubChem (CID 82402785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).