C12H17NO — CID 82403214
2-cyclopentyl-1,4,6,7-tetrahydropyrano[4,3-b]pyrrole (PubChem CID 82403214) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-cyclopentyl-1,4,6,7-tetrahydropyrano[4,3-b]pyrrole.
| Compound Name | 2-cyclopentyl-1,4,6,7-tetrahydropyrano[4,3-b]pyrrole |
|---|---|
| PubChem CID | 82403214 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-cyclopentyl-1,4,6,7-tetrahydropyrano[4,3-b]pyrrole |
| SMILES | c1c(C2CCCC2)[nH]c2c1COCC2 |
| InChI | InChI=1S/C12H17NO/c1-2-4-9(3-1)12-7-10-8-14-6-5-11(10)13-12/h7,9,13H,1-6,8H2 |
| InChIKey | SSMMFRCWTBNPTO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |